C18H19NO2 — CID 11868274
(3R,4R,6R)-4,6-diphenylpiperidine-3-carboxylic acid (PubChem CID 11868274) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is (3R,4R,6R)-4,6-diphenylpiperidine-3-carboxylic acid.
| Compound Name | (3R,4R,6R)-4,6-diphenylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 11868274 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (3R,4R,6R)-4,6-diphenylpiperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CN[C@@H](c2ccccc2)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c20-18(21)16-12-19-17(14-9-5-2-6-10-14)11-15(16)13-7-3-1-4-8-13/h1-10,15-17,19H,11-12H2,(H,20,21)/t15-,16-,17+/m0/s1 |
| InChIKey | NIPZGSKSNHPVNC-YESZJQIVSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |