cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid

C10H10O2 — CID 778516

IUPACcis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@@H]1c1ccccc1
InChIInChI=1S/C10H10O2/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,11,12)/t8-,9-/m1/s1
InChIKeyAHDDRJBFJBDEPW-RKDXNWHRSA-N
MW162.19 g/mol
LogP1.87
Rot. Bonds2

About cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid

cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid (PubChem CID 778516) has the molecular formula C10H10O2 and a molecular weight of 162.19 g/mol. Its IUPAC name is cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid.

Molecular Properties

Compound Namecis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid
PubChem CID778516
Molecular FormulaC10H10O2
Molecular Weight162.19 g/mol
Exact Mass162.07
IUPAC Namecis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid
SMILESO=C(O)[C@@H]1C[C@@H]1c1ccccc1
InChIInChI=1S/C10H10O2/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,11,12)/t8-,9-/m1/s1
InChIKeyAHDDRJBFJBDEPW-RKDXNWHRSA-N
XLogP1.87
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 51.87
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid?
The IUPAC name of cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid (CID 778516) is cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid.
What is the SMILES notation for cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid?
The canonical SMILES for cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid is O=C(O)[C@@H]1C[C@@H]1c1ccccc1.
What is the InChIKey of cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid?
The InChIKey is AHDDRJBFJBDEPW-RKDXNWHRSA-N. The full InChI is InChI=1S/C10H10O2/c11-10(12)9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6H2,(H,11,12)/t8-,9-/m1/s1.
What are the key properties of cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid?
cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid has a molecular weight of 162.19 g/mol, XLogP of 1.87, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(1R,2S)-2-phenylcyclopropane-1-carboxylic acid is sourced from PubChem (CID 778516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).