C14H18O — CID 76612897
2,2-dimethyl-1-(2-phenylcyclopropyl)propan-1-one (PubChem CID 76612897) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,2-dimethyl-1-(2-phenylcyclopropyl)propan-1-one.
| Compound Name | 2,2-dimethyl-1-(2-phenylcyclopropyl)propan-1-one |
|---|---|
| PubChem CID | 76612897 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 2,2-dimethyl-1-(2-phenylcyclopropyl)propan-1-one |
| SMILES | CC(C)(C)C(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-14(2,3)13(15)12-9-11(12)10-7-5-4-6-8-10/h4-8,11-12H,9H2,1-3H3 |
| InChIKey | MKIAYZMITIUVOG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |