C22H24O4 — CID 70636165
ethyl 2-phenylcyclopropane-1-carboxylate;2-phenylcyclopropane-1-carboxylic acid (PubChem CID 70636165) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl 2-phenylcyclopropane-1-carboxylate;2-phenylcyclopropane-1-carboxylic acid.
| Compound Name | ethyl 2-phenylcyclopropane-1-carboxylate;2-phenylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 70636165 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | ethyl 2-phenylcyclopropane-1-carboxylate;2-phenylcyclopropane-1-carboxylic acid |
| SMILES | CCOC(=O)C1CC1c1ccccc1.O=C(O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C12H14O2.C10H10O2/c1-2-14-12(13)11-8-10(11)9-6-4-3-5-7-9;11-10(12)9-6-8(9)7-4-2-1-3-5-7/h3-7,10-11H,2,8H2,1H3;1-5,8-9H,6H2,(H,11,12) |
| InChIKey | IGZQBWCTEBOZLB-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |