C18H26O2 — CID 91709958
octyl 2-phenylcyclopropane-1-carboxylate (PubChem CID 91709958) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is octyl 2-phenylcyclopropane-1-carboxylate.
| Compound Name | octyl 2-phenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 91709958 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | octyl 2-phenylcyclopropane-1-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1CC1c1ccccc1 |
| InChI | InChI=1S/C18H26O2/c1-2-3-4-5-6-10-13-20-18(19)17-14-16(17)15-11-8-7-9-12-15/h7-9,11-12,16-17H,2-6,10,13-14H2,1H3 |
| InChIKey | ANWXAJQWYWWNGX-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|