C24H28O4 — CID 7375089
trans-(2R,4R)-3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 7375089) has the molecular formula C24H28O4 and a molecular weight of 380.48 g/mol. Its IUPAC name is trans-(2R,4R)-3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
| Compound Name | trans-(2R,4R)-3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 7375089 |
| Molecular Formula | C24H28O4 |
| Molecular Weight | 380.48 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | trans-(2R,4R)-3-hexoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | CCCCCCOC(=O)C1[C@H](c2ccccc2)C(C(=O)O)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H28O4/c1-2-3-4-11-16-28-24(27)22-19(17-12-7-5-8-13-17)21(23(25)26)20(22)18-14-9-6-10-15-18/h5-10,12-15,19-22H,2-4,11,16H2,1H3,(H,25,26)/t19-,20-,21?,22?/m1/s1 |
| InChIKey | JBSLSZWLFYDHGN-JTVPBKEVSA-N |
| XLogP | 5.01 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|