C26H32O6 — CID 11442043
2,4-bis(4-butoxyphenyl)cyclobutane-1,3-dicarboxylic acid (PubChem CID 11442043) has the molecular formula C26H32O6 and a molecular weight of 440.54 g/mol. Its IUPAC name is 2,4-bis(4-butoxyphenyl)cyclobutane-1,3-dicarboxylic acid.
| Compound Name | 2,4-bis(4-butoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 11442043 |
| Molecular Formula | C26H32O6 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | 2,4-bis(4-butoxyphenyl)cyclobutane-1,3-dicarboxylic acid |
| SMILES | CCCCOc1ccc(C2C(C(=O)O)C(c3ccc(OCCCC)cc3)C2C(=O)O)cc1 |
| InChI | InChI=1S/C26H32O6/c1-3-5-15-31-19-11-7-17(8-12-19)21-23(25(27)28)22(24(21)26(29)30)18-9-13-20(14-10-18)32-16-6-4-2/h7-14,21-24H,3-6,15-16H2,1-2H3,(H,27,28)(H,29,30) |
| InChIKey | BMRKKAPLNFPOJS-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|