C22H24O4 — CID 171979757
3-butoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid (PubChem CID 171979757) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-butoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid.
| Compound Name | 3-butoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 171979757 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 3-butoxycarbonyl-2,4-diphenylcyclobutane-1-carboxylic acid |
| SMILES | CCCCOC(=O)C1C(c2ccccc2)C(C(=O)O)C1c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-2-3-14-26-22(25)20-17(15-10-6-4-7-11-15)19(21(23)24)18(20)16-12-8-5-9-13-16/h4-13,17-20H,2-3,14H2,1H3,(H,23,24) |
| InChIKey | MTIKPOUQOZRHDH-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|