C23H24O4 — CID 21231858
2,5-diphenyl-6-propoxycarbonylcyclohex-3-ene-1-carboxylic acid (PubChem CID 21231858) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is 2,5-diphenyl-6-propoxycarbonylcyclohex-3-ene-1-carboxylic acid.
| Compound Name | 2,5-diphenyl-6-propoxycarbonylcyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 21231858 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | 2,5-diphenyl-6-propoxycarbonylcyclohex-3-ene-1-carboxylic acid |
| SMILES | CCCOC(=O)C1C(c2ccccc2)C=CC(c2ccccc2)C1C(=O)O |
| InChI | InChI=1S/C23H24O4/c1-2-15-27-23(26)21-19(17-11-7-4-8-12-17)14-13-18(20(21)22(24)25)16-9-5-3-6-10-16/h3-14,18-21H,2,15H2,1H3,(H,24,25) |
| InChIKey | HDJWIJGJIFBFEB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|