About trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid
trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (PubChem CID 6993920) has the molecular formula C10H9ClO2
and a molecular weight of 196.63 g/mol. Its IUPAC name is trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid.
Analyze trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid?
The IUPAC name of trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid (CID 6993920) is trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid.
What is the SMILES notation for trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid?
The canonical SMILES for trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid is O=C(O)[C@@H]1C[C@H]1c1ccc(Cl)cc1.
What is the InChIKey of trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid?
The InChIKey is JZYXJKBNUJJIKU-DTWKUNHWSA-N. The full InChI is InChI=1S/C10H9ClO2/c11-7-3-1-6(2-4-7)8-5-9(8)10(12)13/h1-4,8-9H,5H2,(H,12,13)/t8-,9+/m0/s1.
What are the key properties of trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid?
trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid has a molecular weight of 196.63 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,2R)-2-(4-chlorophenyl)cyclopropane-1-carboxylic acid is sourced from PubChem (CID 6993920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).