C12H14Cl2O2 — CID 88785384
carbonochloridic acid;1-chloro-4-(2-methylcyclobutyl)benzene (PubChem CID 88785384) has the molecular formula C12H14Cl2O2 and a molecular weight of 261.15 g/mol. Its IUPAC name is carbonochloridic acid;1-chloro-4-(2-methylcyclobutyl)benzene.
| Compound Name | carbonochloridic acid;1-chloro-4-(2-methylcyclobutyl)benzene |
|---|---|
| PubChem CID | 88785384 |
| Molecular Formula | C12H14Cl2O2 |
| Molecular Weight | 261.15 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | carbonochloridic acid;1-chloro-4-(2-methylcyclobutyl)benzene |
| SMILES | CC1CCC1c1ccc(Cl)cc1.O=C(O)Cl |
| InChI | InChI=1S/C11H13Cl.CHClO2/c1-8-2-7-11(8)9-3-5-10(12)6-4-9;2-1(3)4/h3-6,8,11H,2,7H2,1H3;(H,3,4) |
| InChIKey | HXWYXBNCKGYGCN-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.15 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|