C16H13ClO — CID 27327097
[(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-phenylmethanone (PubChem CID 27327097) has the molecular formula C16H13ClO and a molecular weight of 256.73 g/mol. Its IUPAC name is [(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-phenylmethanone.
| Compound Name | [(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-phenylmethanone |
|---|---|
| PubChem CID | 27327097 |
| Molecular Formula | C16H13ClO |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | [(1R,2R)-2-(4-chlorophenyl)cyclopropyl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H13ClO/c17-13-8-6-11(7-9-13)14-10-15(14)16(18)12-4-2-1-3-5-12/h1-9,14-15H,10H2/t14-,15+/m0/s1 |
| InChIKey | BQJIEIMRDLHQRY-LSDHHAIUSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |