C17H15ClO2 — CID 10266040
[(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-phenylmethanone (PubChem CID 10266040) has the molecular formula C17H15ClO2 and a molecular weight of 286.76 g/mol. Its IUPAC name is [(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-phenylmethanone.
| Compound Name | [(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10266040 |
| Molecular Formula | C17H15ClO2 |
| Molecular Weight | 286.76 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | [(2R,3R)-2-(4-chlorophenyl)oxolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CCO[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H15ClO2/c18-14-8-6-13(7-9-14)17-15(10-11-20-17)16(19)12-4-2-1-3-5-12/h1-9,15,17H,10-11H2/t15-,17-/m0/s1 |
| InChIKey | OTELXXMXKQNWDD-RDJZCZTQSA-N |
| XLogP | 4.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.76 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |