C17H15NO4 — CID 11779363
[(2S,3R)-2-(4-nitrophenyl)oxolan-3-yl]-phenylmethanone (PubChem CID 11779363) has the molecular formula C17H15NO4 and a molecular weight of 297.31 g/mol. Its IUPAC name is [(2S,3R)-2-(4-nitrophenyl)oxolan-3-yl]-phenylmethanone.
| Compound Name | [(2S,3R)-2-(4-nitrophenyl)oxolan-3-yl]-phenylmethanone |
|---|---|
| PubChem CID | 11779363 |
| Molecular Formula | C17H15NO4 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [(2S,3R)-2-(4-nitrophenyl)oxolan-3-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)[C@@H]1CCO[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H15NO4/c19-16(12-4-2-1-3-5-12)15-10-11-22-17(15)13-6-8-14(9-7-13)18(20)21/h1-9,15,17H,10-11H2/t15-,17+/m0/s1 |
| InChIKey | CSEJXVJVKKGJSP-DOTOQJQBSA-N |
| XLogP | 3.56 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|