C18H17NO4 — CID 102193376
(1S)-1-[(2S,3S)-2-(4-nitrophenyl)oxolan-3-yl]-1,3-dihydro-2-benzofuran (PubChem CID 102193376) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is (1S)-1-[(2S,3S)-2-(4-nitrophenyl)oxolan-3-yl]-1,3-dihydro-2-benzofuran.
| Compound Name | (1S)-1-[(2S,3S)-2-(4-nitrophenyl)oxolan-3-yl]-1,3-dihydro-2-benzofuran |
|---|---|
| PubChem CID | 102193376 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | (1S)-1-[(2S,3S)-2-(4-nitrophenyl)oxolan-3-yl]-1,3-dihydro-2-benzofuran |
| SMILES | O=[N+]([O-])c1ccc([C@H]2OCC[C@@H]2[C@@H]2OCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H17NO4/c20-19(21)14-7-5-12(6-8-14)17-16(9-10-22-17)18-15-4-2-1-3-13(15)11-23-18/h1-8,16-18H,9-11H2/t16-,17+,18+/m0/s1 |
| InChIKey | FWWWUFDSOFUDDC-RCCFBDPRSA-N |
| XLogP | 3.94 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|