C14H12N2O4S — CID 617357
4-(4-nitrophenyl)-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide (PubChem CID 617357) has the molecular formula C14H12N2O4S and a molecular weight of 304.33 g/mol. Its IUPAC name is 4-(4-nitrophenyl)-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide.
| Compound Name | 4-(4-nitrophenyl)-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide |
|---|---|
| PubChem CID | 617357 |
| Molecular Formula | C14H12N2O4S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 4-(4-nitrophenyl)-3,4-dihydro-1H-2lambda6,3-benzothiazine 2,2-dioxide |
| SMILES | O=[N+]([O-])c1ccc(C2NS(=O)(=O)Cc3ccccc32)cc1 |
| InChI | InChI=1S/C14H12N2O4S/c17-16(18)12-7-5-10(6-8-12)14-13-4-2-1-3-11(13)9-21(19,20)15-14/h1-8,14-15H,9H2 |
| InChIKey | SFUVCIHUHZHUDI-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|