C15H13NO2 — CID 15891688
1-nitro-4-[(1R,2R)-2-phenylcyclopropyl]benzene (PubChem CID 15891688) has the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. Its IUPAC name is 1-nitro-4-[(1R,2R)-2-phenylcyclopropyl]benzene.
| Compound Name | 1-nitro-4-[(1R,2R)-2-phenylcyclopropyl]benzene |
|---|---|
| PubChem CID | 15891688 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 1-nitro-4-[(1R,2R)-2-phenylcyclopropyl]benzene |
| SMILES | O=[N+]([O-])c1ccc([C@@H]2C[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C15H13NO2/c17-16(18)13-8-6-12(7-9-13)15-10-14(15)11-4-2-1-3-5-11/h1-9,14-15H,10H2/t14-,15-/m0/s1 |
| InChIKey | LYOHDPNWNLNIED-GJZGRUSLSA-N |
| XLogP | 3.87 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|