C18H20N2O3S — CID 135059647
(2R,3R)-1-[(R)-tert-butylsulfinyl]-2-(4-nitrophenyl)-3-phenylaziridine (PubChem CID 135059647) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is (2R,3R)-1-[(R)-tert-butylsulfinyl]-2-(4-nitrophenyl)-3-phenylaziridine.
| Compound Name | (2R,3R)-1-[(R)-tert-butylsulfinyl]-2-(4-nitrophenyl)-3-phenylaziridine |
|---|---|
| PubChem CID | 135059647 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | (2R,3R)-1-[(R)-tert-butylsulfinyl]-2-(4-nitrophenyl)-3-phenylaziridine |
| SMILES | CC(C)(C)[S@@](=O)N1[C@H](c2ccccc2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H20N2O3S/c1-18(2,3)24(23)19-16(13-7-5-4-6-8-13)17(19)14-9-11-15(12-10-14)20(21)22/h4-12,16-17H,1-3H3/t16-,17-,19?,24-/m1/s1 |
| InChIKey | UGGDZLIUIPPGLK-VAOYFBBDSA-N |
| XLogP | 4.16 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|