C14H21NOS — CID 102254705
(3R)-1-tert-butylsulfinyl-2,2-dimethyl-3-phenylaziridine (PubChem CID 102254705) has the molecular formula C14H21NOS and a molecular weight of 251.40 g/mol. Its IUPAC name is (3R)-1-tert-butylsulfinyl-2,2-dimethyl-3-phenylaziridine.
| Compound Name | (3R)-1-tert-butylsulfinyl-2,2-dimethyl-3-phenylaziridine |
|---|---|
| PubChem CID | 102254705 |
| Molecular Formula | C14H21NOS |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | (3R)-1-tert-butylsulfinyl-2,2-dimethyl-3-phenylaziridine |
| SMILES | CC1(C)[C@@H](c2ccccc2)N1S(=O)C(C)(C)C |
| InChI | InChI=1S/C14H21NOS/c1-13(2,3)17(16)15-12(14(15,4)5)11-9-7-6-8-10-11/h6-10,12H,1-5H3/t12-,15?,17?/m1/s1 |
| InChIKey | RUYGJVDGCIGWLG-OLJMKKDRSA-N |
| XLogP | 3.28 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|