C15H21NO3S — CID 53495328
ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-phenylaziridine-2-carboxylate (PubChem CID 53495328) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 53495328 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccccc2)N1[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C15H21NO3S/c1-5-19-14(17)13-12(11-9-7-6-8-10-11)16(13)20(18)15(2,3)4/h6-10,12-13H,5H2,1-4H3/t12-,13-,16?,20-/m0/s1 |
| InChIKey | RHNDKTPAOKXOHK-QFVVXOCBSA-N |
| XLogP | 2.44 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|