C17H33NO3S — CID 53495470
ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-octylaziridine-2-carboxylate (PubChem CID 53495470) has the molecular formula C17H33NO3S and a molecular weight of 331.52 g/mol. Its IUPAC name is ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-octylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-octylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 53495470 |
| Molecular Formula | C17H33NO3S |
| Molecular Weight | 331.52 g/mol |
| Exact Mass | 331.22 |
| IUPAC Name | ethyl (2S,3S)-1-[(S)-tert-butylsulfinyl]-3-octylaziridine-2-carboxylate |
| SMILES | CCCCCCCC[C@H]1[C@@H](C(=O)OCC)N1[S@@](=O)C(C)(C)C |
| InChI | InChI=1S/C17H33NO3S/c1-6-8-9-10-11-12-13-14-15(16(19)21-7-2)18(14)22(20)17(3,4)5/h14-15H,6-13H2,1-5H3/t14-,15-,18?,22-/m0/s1 |
| InChIKey | XRCSHUYCQLHDML-YIIJHYEZSA-N |
| XLogP | 3.82 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|