C12H22O2 — CID 140932694
ethyl (1R,2R,3S)-2-methyl-3-pentylcyclopropane-1-carboxylate (PubChem CID 140932694) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is ethyl (1R,2R,3S)-2-methyl-3-pentylcyclopropane-1-carboxylate.
| Compound Name | ethyl (1R,2R,3S)-2-methyl-3-pentylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 140932694 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | ethyl (1R,2R,3S)-2-methyl-3-pentylcyclopropane-1-carboxylate |
| SMILES | CCCCC[C@H]1[C@@H](C)[C@H]1C(=O)OCC |
| InChI | InChI=1S/C12H22O2/c1-4-6-7-8-10-9(3)11(10)12(13)14-5-2/h9-11H,4-8H2,1-3H3/t9-,10+,11-/m1/s1 |
| InChIKey | VIZGQHIMFXMUPS-OUAUKWLOSA-N |
| XLogP | 3.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|