C8H12Br2O2 — CID 11822694
cis-ethyl (2R,3S)-2,3-bis(bromomethyl)cyclopropane-1-carboxylate (PubChem CID 11822694) has the molecular formula C8H12Br2O2 and a molecular weight of 299.99 g/mol. Its IUPAC name is cis-ethyl (2R,3S)-2,3-bis(bromomethyl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (2R,3S)-2,3-bis(bromomethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 11822694 |
| Molecular Formula | C8H12Br2O2 |
| Molecular Weight | 299.99 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | cis-ethyl (2R,3S)-2,3-bis(bromomethyl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1[C@@H](CBr)[C@H]1CBr |
| InChI | InChI=1S/C8H12Br2O2/c1-2-12-8(11)7-5(3-9)6(7)4-10/h5-7H,2-4H2,1H3/t5-,6+,7? |
| InChIKey | XJVKDIZCCIRPAP-MEKDEQNOSA-N |
| XLogP | 2.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.99 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|