About ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate
ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate (PubChem CID 67079479) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate |
| PubChem CID | 67079479 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate |
| SMILES | CCCCCC1NN=NC1C(=O)OCC |
| InChI | InChI=1S/C10H19N3O2/c1-3-5-6-7-8-9(12-13-11-8)10(14)15-4-2/h8-9H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | KIORYEBKGORWNX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate?
The IUPAC name of ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate (CID 67079479) is ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate.
What is the SMILES notation for ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate?
The canonical SMILES for ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate is CCCCCC1NN=NC1C(=O)OCC.
What is the InChIKey of ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate?
The InChIKey is KIORYEBKGORWNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c1-3-5-6-7-8-9(12-13-11-8)10(14)15-4-2/h8-9H,3-7H2,1-2H3,(H,11,12).
What are the key properties of ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate?
ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.84, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-pentyl-4,5-dihydro-1H-triazole-4-carboxylate is sourced from PubChem (CID 67079479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).