C16H31NO3 — CID 11335133
ethyl (2S,3S,6R)-2-(3-hydroxypropyl)-6-pentylpiperidine-3-carboxylate (PubChem CID 11335133) has the molecular formula C16H31NO3 and a molecular weight of 285.43 g/mol. Its IUPAC name is ethyl (2S,3S,6R)-2-(3-hydroxypropyl)-6-pentylpiperidine-3-carboxylate.
| Compound Name | ethyl (2S,3S,6R)-2-(3-hydroxypropyl)-6-pentylpiperidine-3-carboxylate |
|---|---|
| PubChem CID | 11335133 |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.23 |
| IUPAC Name | ethyl (2S,3S,6R)-2-(3-hydroxypropyl)-6-pentylpiperidine-3-carboxylate |
| SMILES | CCCCC[C@@H]1CC[C@H](C(=O)OCC)[C@H](CCCO)N1 |
| InChI | InChI=1S/C16H31NO3/c1-3-5-6-8-13-10-11-14(16(19)20-4-2)15(17-13)9-7-12-18/h13-15,17-18H,3-12H2,1-2H3/t13-,14+,15+/m1/s1 |
| InChIKey | JOEXGAMJUVPXMD-ILXRZTDVSA-N |
| XLogP | 2.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|