C16H29NO2 — CID 11032852
ethyl (E)-3-[(2R,3R,6R)-3-methyl-6-pentylpiperidin-2-yl]prop-2-enoate (PubChem CID 11032852) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is ethyl (E)-3-[(2R,3R,6R)-3-methyl-6-pentylpiperidin-2-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(2R,3R,6R)-3-methyl-6-pentylpiperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11032852 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | ethyl (E)-3-[(2R,3R,6R)-3-methyl-6-pentylpiperidin-2-yl]prop-2-enoate |
| SMILES | CCCCC[C@@H]1CC[C@@H](C)[C@H](/C=C/C(=O)OCC)N1 |
| InChI | InChI=1S/C16H29NO2/c1-4-6-7-8-14-10-9-13(3)15(17-14)11-12-16(18)19-5-2/h11-15,17H,4-10H2,1-3H3/b12-11+/t13-,14-,15+/m1/s1 |
| InChIKey | CYDDMLNRSLENNA-OTZHNRCDSA-N |
| XLogP | 3.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|