C11H23N — CID 71392396
(2S,5S)-2-ethyl-5-pentylpyrrolidine (PubChem CID 71392396) has the molecular formula C11H23N and a molecular weight of 169.31 g/mol. Its IUPAC name is (2S,5S)-2-ethyl-5-pentylpyrrolidine.
| Compound Name | (2S,5S)-2-ethyl-5-pentylpyrrolidine |
|---|---|
| PubChem CID | 71392396 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | (2S,5S)-2-ethyl-5-pentylpyrrolidine |
| SMILES | CCCCC[C@H]1CC[C@H](CC)N1 |
| InChI | InChI=1S/C11H23N/c1-3-5-6-7-11-9-8-10(4-2)12-11/h10-12H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | LJQWKQLTDIWXEV-QWRGUYRKSA-N |
| XLogP | 3.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|