C19H35N — CID 71662832
(2R,5R)-2-hexyl-5-non-2-ynylpyrrolidine (PubChem CID 71662832) has the molecular formula C19H35N and a molecular weight of 277.50 g/mol. Its IUPAC name is (2R,5R)-2-hexyl-5-non-2-ynylpyrrolidine.
| Compound Name | (2R,5R)-2-hexyl-5-non-2-ynylpyrrolidine |
|---|---|
| PubChem CID | 71662832 |
| Molecular Formula | C19H35N |
| Molecular Weight | 277.50 g/mol |
| Exact Mass | 277.28 |
| IUPAC Name | (2R,5R)-2-hexyl-5-non-2-ynylpyrrolidine |
| SMILES | CCCCCCC#CC[C@H]1CC[C@@H](CCCCCC)N1 |
| InChI | InChI=1S/C19H35N/c1-3-5-7-9-10-11-13-15-19-17-16-18(20-19)14-12-8-6-4-2/h18-20H,3-10,12,14-17H2,1-2H3/t18-,19+/m1/s1 |
| InChIKey | YWTKVEXBWHTYNI-MOPGFXCFSA-N |
| XLogP | 5.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.50 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|