C20H41N — CID 15722672
(2S,5R)-2-methyl-5-pentadecylpyrrolidine (PubChem CID 15722672) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is (2S,5R)-2-methyl-5-pentadecylpyrrolidine.
| Compound Name | (2S,5R)-2-methyl-5-pentadecylpyrrolidine |
|---|---|
| PubChem CID | 15722672 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | (2S,5R)-2-methyl-5-pentadecylpyrrolidine |
| SMILES | CCCCCCCCCCCCCCC[C@@H]1CC[C@H](C)N1 |
| InChI | InChI=1S/C20H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20-18-17-19(2)21-20/h19-21H,3-18H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | IZDGWKWZCJCEHE-VQTJNVASSA-N |
| XLogP | 6.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|