C21H41N — CID 131877830
(2R,6R)-2-methyl-6-[(Z)-pentadec-6-enyl]piperidine (PubChem CID 131877830) has the molecular formula C21H41N and a molecular weight of 307.57 g/mol. Its IUPAC name is (2R,6R)-2-methyl-6-[(Z)-pentadec-6-enyl]piperidine.
| Compound Name | (2R,6R)-2-methyl-6-[(Z)-pentadec-6-enyl]piperidine |
|---|---|
| PubChem CID | 131877830 |
| Molecular Formula | C21H41N |
| Molecular Weight | 307.57 g/mol |
| Exact Mass | 307.32 |
| IUPAC Name | (2R,6R)-2-methyl-6-[(Z)-pentadec-6-enyl]piperidine |
| SMILES | CCCCCCCC/C=C\CCCCC[C@@H]1CCC[C@@H](C)N1 |
| InChI | InChI=1S/C21H41N/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-18-21-19-16-17-20(2)22-21/h10-11,20-22H,3-9,12-19H2,1-2H3/b11-10-/t20-,21-/m1/s1 |
| InChIKey | MCONQKHTWCXBGX-XUGGCNTGSA-N |
| XLogP | 6.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.57 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|