C12H25N — CID 10846548
(2R,5R)-2-pentyl-5-propylpyrrolidine (PubChem CID 10846548) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is (2R,5R)-2-pentyl-5-propylpyrrolidine.
| Compound Name | (2R,5R)-2-pentyl-5-propylpyrrolidine |
|---|---|
| PubChem CID | 10846548 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | (2R,5R)-2-pentyl-5-propylpyrrolidine |
| SMILES | CCCCC[C@@H]1CC[C@@H](CCC)N1 |
| InChI | InChI=1S/C12H25N/c1-3-5-6-8-12-10-9-11(13-12)7-4-2/h11-13H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | LIJKTVPXFZLKGK-VXGBXAGGSA-N |
| XLogP | 3.49 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|