C9H19NO — CID 131230214
[(2S,5S)-5-butylpyrrolidin-2-yl]methanol (PubChem CID 131230214) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is [(2S,5S)-5-butylpyrrolidin-2-yl]methanol.
| Compound Name | [(2S,5S)-5-butylpyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 131230214 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | [(2S,5S)-5-butylpyrrolidin-2-yl]methanol |
| SMILES | CCCC[C@H]1CC[C@@H](CO)N1 |
| InChI | InChI=1S/C9H19NO/c1-2-3-4-8-5-6-9(7-11)10-8/h8-11H,2-7H2,1H3/t8-,9-/m0/s1 |
| InChIKey | JNWXVWDJGMVGTM-IUCAKERBSA-N |
| XLogP | 1.29 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |