C14H30ClN — CID 44889697
(2R,5R)-2,5-dipentylpyrrolidine;hydrochloride (PubChem CID 44889697) has the molecular formula C14H30ClN and a molecular weight of 247.85 g/mol. Its IUPAC name is (2R,5R)-2,5-dipentylpyrrolidine;hydrochloride.
| Compound Name | (2R,5R)-2,5-dipentylpyrrolidine;hydrochloride |
|---|---|
| PubChem CID | 44889697 |
| Molecular Formula | C14H30ClN |
| Molecular Weight | 247.85 g/mol |
| Exact Mass | 247.21 |
| IUPAC Name | (2R,5R)-2,5-dipentylpyrrolidine;hydrochloride |
| SMILES | CCCCC[C@@H]1CC[C@@H](CCCCC)N1.Cl |
| InChI | InChI=1S/C14H29N.ClH/c1-3-5-7-9-13-11-12-14(15-13)10-8-6-4-2;/h13-15H,3-12H2,1-2H3;1H/t13-,14-;/m1./s1 |
| InChIKey | IWKXZOJZALUQQY-DTPOWOMPSA-N |
| XLogP | 4.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.85 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|