C13H23NO3 — CID 11834585
ethyl 4-hexyl-2-methyl-4,5-dihydro-1,3-oxazole-5-carboxylate (PubChem CID 11834585) has the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. Its IUPAC name is ethyl 4-hexyl-2-methyl-4,5-dihydro-1,3-oxazole-5-carboxylate.
| Compound Name | ethyl 4-hexyl-2-methyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
|---|---|
| PubChem CID | 11834585 |
| Molecular Formula | C13H23NO3 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.17 |
| IUPAC Name | ethyl 4-hexyl-2-methyl-4,5-dihydro-1,3-oxazole-5-carboxylate |
| SMILES | CCCCCCC1N=C(C)OC1C(=O)OCC |
| InChI | InChI=1S/C13H23NO3/c1-4-6-7-8-9-11-12(13(15)16-5-2)17-10(3)14-11/h11-12H,4-9H2,1-3H3 |
| InChIKey | YTAGBHAZHZJPHG-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|