C18H30O4 — CID 71394059
ethyl 2-nonyl-4,6-dioxocyclohexane-1-carboxylate (PubChem CID 71394059) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is ethyl 2-nonyl-4,6-dioxocyclohexane-1-carboxylate.
| Compound Name | ethyl 2-nonyl-4,6-dioxocyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71394059 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | ethyl 2-nonyl-4,6-dioxocyclohexane-1-carboxylate |
| SMILES | CCCCCCCCCC1CC(=O)CC(=O)C1C(=O)OCC |
| InChI | InChI=1S/C18H30O4/c1-3-5-6-7-8-9-10-11-14-12-15(19)13-16(20)17(14)18(21)22-4-2/h14,17H,3-13H2,1-2H3 |
| InChIKey | HBTFLELDYFBBGX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|