About cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one
cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one (PubChem CID 134987220) has the molecular formula C14H26O
and a molecular weight of 210.36 g/mol. Its IUPAC name is cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one.
Molecular Properties
| Compound Name | cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one |
| PubChem CID | 134987220 |
| Molecular Formula | C14H26O |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one |
| SMILES | CCCCCC[C@@H]1CC(=O)C[C@@H]1CCC |
| InChI | InChI=1S/C14H26O/c1-3-5-6-7-9-13-11-14(15)10-12(13)8-4-2/h12-13H,3-11H2,1-2H3/t12-,13+/m0/s1 |
| InChIKey | HYJNAUOWNATNTE-QWHCGFSZSA-N |
| XLogP | 4.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one?
The IUPAC name of cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one (CID 134987220) is cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one.
What is the SMILES notation for cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one?
The canonical SMILES for cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one is CCCCCC[C@@H]1CC(=O)C[C@@H]1CCC.
What is the InChIKey of cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one?
The InChIKey is HYJNAUOWNATNTE-QWHCGFSZSA-N. The full InChI is InChI=1S/C14H26O/c1-3-5-6-7-9-13-11-14(15)10-12(13)8-4-2/h12-13H,3-11H2,1-2H3/t12-,13+/m0/s1.
What are the key properties of cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one?
cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one has a molecular weight of 210.36 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cis-(3R,4S)-3-hexyl-4-propylcyclopentan-1-one is sourced from PubChem (CID 134987220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).