C13H24O2 — CID 101419586
(4R,5S)-4,5-dibutyloxan-2-one (PubChem CID 101419586) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (4R,5S)-4,5-dibutyloxan-2-one.
| Compound Name | (4R,5S)-4,5-dibutyloxan-2-one |
|---|---|
| PubChem CID | 101419586 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (4R,5S)-4,5-dibutyloxan-2-one |
| SMILES | CCCC[C@@H]1COC(=O)C[C@H]1CCCC |
| InChI | InChI=1S/C13H24O2/c1-3-5-7-11-9-13(14)15-10-12(11)8-6-4-2/h11-12H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | WSXVZWLMHJFKHH-VXGBXAGGSA-N |
| XLogP | 3.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |