C9H16O2 — CID 101032694
(3S,4S)-4-ethyl-3-propyloxolan-2-one (PubChem CID 101032694) has the molecular formula C9H16O2 and a molecular weight of 156.23 g/mol. Its IUPAC name is (3S,4S)-4-ethyl-3-propyloxolan-2-one.
| Compound Name | (3S,4S)-4-ethyl-3-propyloxolan-2-one |
|---|---|
| PubChem CID | 101032694 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | (3S,4S)-4-ethyl-3-propyloxolan-2-one |
| SMILES | CCC[C@@H]1C(=O)OC[C@H]1CC |
| InChI | InChI=1S/C9H16O2/c1-3-5-8-7(4-2)6-11-9(8)10/h7-8H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | GRJPFASLUAHZDT-SFYZADRCSA-N |
| XLogP | 1.99 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |