C14H24O6 — CID 162009451
4-butyl-1,3-dioxolan-2-one (PubChem CID 162009451) has the molecular formula C14H24O6 and a molecular weight of 288.34 g/mol. Its IUPAC name is 4-butyl-1,3-dioxolan-2-one.
| Compound Name | 4-butyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 162009451 |
| Molecular Formula | C14H24O6 |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 4-butyl-1,3-dioxolan-2-one |
| SMILES | CCCCC1COC(=O)O1.CCCCC1COC(=O)O1 |
| InChI | InChI=1S/2C7H12O3/c2*1-2-3-4-6-5-9-7(8)10-6/h2*6H,2-5H2,1H3 |
| InChIKey | YTGUELNJMHLIHQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |