C8H14O3 — CID 138595323
4-(3-methylbutyl)-1,3-dioxolan-2-one (PubChem CID 138595323) has the molecular formula C8H14O3 and a molecular weight of 158.20 g/mol. Its IUPAC name is 4-(3-methylbutyl)-1,3-dioxolan-2-one.
| Compound Name | 4-(3-methylbutyl)-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 138595323 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 4-(3-methylbutyl)-1,3-dioxolan-2-one |
| SMILES | CC(C)CCC1COC(=O)O1 |
| InChI | InChI=1S/C8H14O3/c1-6(2)3-4-7-5-10-8(9)11-7/h6-7H,3-5H2,1-2H3 |
| InChIKey | CKICWMMLWPPWOE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |