C6H11O5+ — CID 142966378
1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyloxidanium (PubChem CID 142966378) has the molecular formula C6H11O5+ and a molecular weight of 163.15 g/mol. Its IUPAC name is 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyloxidanium.
| Compound Name | 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyloxidanium |
|---|---|
| PubChem CID | 142966378 |
| Molecular Formula | C6H11O5+ |
| Molecular Weight | 163.15 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | 1-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyloxidanium |
| SMILES | CC([OH2+])OCC1COC(=O)O1 |
| InChI | InChI=1S/C6H10O5/c1-4(7)9-2-5-3-10-6(8)11-5/h4-5,7H,2-3H2,1H3/p+1 |
| InChIKey | KNJISRJLBQBFJP-UHFFFAOYSA-O |
| XLogP | -0.39 |
| TPSA | 67.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.15 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|