C8H10O6 — CID 157036865
(2-oxo-1,3-dioxolan-4-yl)methyl 3-oxobutanoate (PubChem CID 157036865) has the molecular formula C8H10O6 and a molecular weight of 202.16 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 3-oxobutanoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 3-oxobutanoate |
|---|---|
| PubChem CID | 157036865 |
| Molecular Formula | C8H10O6 |
| Molecular Weight | 202.16 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C8H10O6/c1-5(9)2-7(10)12-3-6-4-13-8(11)14-6/h6H,2-4H2,1H3 |
| InChIKey | JCNWAPSJMIMFFD-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.16 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|