C13H20O7 — CID 159032301
[2-oxo-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyl] 2,2-dimethylpentanoate (PubChem CID 159032301) has the molecular formula C13H20O7 and a molecular weight of 288.30 g/mol. Its IUPAC name is [2-oxo-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyl] 2,2-dimethylpentanoate.
| Compound Name | [2-oxo-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyl] 2,2-dimethylpentanoate |
|---|---|
| PubChem CID | 159032301 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | [2-oxo-2-[(2-oxo-1,3-dioxolan-4-yl)methoxy]ethyl] 2,2-dimethylpentanoate |
| SMILES | CCCC(C)(C)C(=O)OCC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C13H20O7/c1-4-5-13(2,3)11(15)18-8-10(14)17-6-9-7-19-12(16)20-9/h9H,4-8H2,1-3H3 |
| InChIKey | KJTIRMWZSVCQJJ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|