C7H10O6 — CID 14765868
(2-oxo-1,3-dioxolan-4-yl)methyl 2-methoxyacetate (PubChem CID 14765868) has the molecular formula C7H10O6 and a molecular weight of 190.15 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 2-methoxyacetate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 2-methoxyacetate |
|---|---|
| PubChem CID | 14765868 |
| Molecular Formula | C7H10O6 |
| Molecular Weight | 190.15 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 2-methoxyacetate |
| SMILES | COCC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C7H10O6/c1-10-4-6(8)11-2-5-3-12-7(9)13-5/h5H,2-4H2,1H3 |
| InChIKey | NCOABCDWKLBJOM-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.15 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |