C12H14O9 — CID 158834493
1-O-[(2-methylidene-1,3-dioxolan-4-yl)methyl] 3-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] propanedioate (PubChem CID 158834493) has the molecular formula C12H14O9 and a molecular weight of 302.24 g/mol. Its IUPAC name is 1-O-[(2-methylidene-1,3-dioxolan-4-yl)methyl] 3-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] propanedioate.
| Compound Name | 1-O-[(2-methylidene-1,3-dioxolan-4-yl)methyl] 3-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] propanedioate |
|---|---|
| PubChem CID | 158834493 |
| Molecular Formula | C12H14O9 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 1-O-[(2-methylidene-1,3-dioxolan-4-yl)methyl] 3-O-[(2-oxo-1,3-dioxolan-4-yl)methyl] propanedioate |
| SMILES | C=C1OCC(COC(=O)CC(=O)OCC2COC(=O)O2)O1 |
| InChI | InChI=1S/C12H14O9/c1-7-16-3-8(20-7)4-17-10(13)2-11(14)18-5-9-6-19-12(15)21-9/h8-9H,1-6H2 |
| InChIKey | NHYKEIRFRCAZSY-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|