C8H10O7 — CID 150514849
(2-oxo-1,3-dioxolan-4-yl)methoxycarbonyl propanoate (PubChem CID 150514849) has the molecular formula C8H10O7 and a molecular weight of 218.16 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methoxycarbonyl propanoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methoxycarbonyl propanoate |
|---|---|
| PubChem CID | 150514849 |
| Molecular Formula | C8H10O7 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methoxycarbonyl propanoate |
| SMILES | CCC(=O)OC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C8H10O7/c1-2-6(9)15-8(11)13-4-5-3-12-7(10)14-5/h5H,2-4H2,1H3 |
| InChIKey | IAPJWEQMGFQDRK-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|