C11H14O8 — CID 22381518
2-[(2-oxo-1,3-dioxolan-4-yl)methoxycarbonyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 22381518) has the molecular formula C11H14O8 and a molecular weight of 274.22 g/mol. Its IUPAC name is 2-[(2-oxo-1,3-dioxolan-4-yl)methoxycarbonyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[(2-oxo-1,3-dioxolan-4-yl)methoxycarbonyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22381518 |
| Molecular Formula | C11H14O8 |
| Molecular Weight | 274.22 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 2-[(2-oxo-1,3-dioxolan-4-yl)methoxycarbonyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C11H14O8/c1-7(2)9(12)15-3-4-16-10(13)17-5-8-6-18-11(14)19-8/h8H,1,3-6H2,2H3 |
| InChIKey | RQYWJMLOXPUIBO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|