C11H15BrO5 — CID 164883595
(2-oxo-1,3-dioxolan-4-yl)methyl 6-bromo-2-methylidenehexanoate (PubChem CID 164883595) has the molecular formula C11H15BrO5 and a molecular weight of 307.14 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 6-bromo-2-methylidenehexanoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 6-bromo-2-methylidenehexanoate |
|---|---|
| PubChem CID | 164883595 |
| Molecular Formula | C11H15BrO5 |
| Molecular Weight | 307.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 6-bromo-2-methylidenehexanoate |
| SMILES | C=C(CCCCBr)C(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C11H15BrO5/c1-8(4-2-3-5-12)10(13)15-6-9-7-16-11(14)17-9/h9H,1-7H2 |
| InChIKey | HEZQMHKSEATBNJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.14 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|