C28H44O10 — CID 132917919
bis[(2-oxo-1,3-dioxolan-4-yl)methyl] (E)-icos-10-enedioate (PubChem CID 132917919) has the molecular formula C28H44O10 and a molecular weight of 540.65 g/mol. Its IUPAC name is bis[(2-oxo-1,3-dioxolan-4-yl)methyl] (E)-icos-10-enedioate.
| Compound Name | bis[(2-oxo-1,3-dioxolan-4-yl)methyl] (E)-icos-10-enedioate |
|---|---|
| PubChem CID | 132917919 |
| Molecular Formula | C28H44O10 |
| Molecular Weight | 540.65 g/mol |
| Exact Mass | 540.29 |
| IUPAC Name | bis[(2-oxo-1,3-dioxolan-4-yl)methyl] (E)-icos-10-enedioate |
| SMILES | O=C(CCCCCCCC/C=C/CCCCCCCCC(=O)OCC1COC(=O)O1)OCC1COC(=O)O1 |
| InChI | InChI=1S/C28H44O10/c29-25(33-19-23-21-35-27(31)37-23)17-15-13-11-9-7-5-3-1-2-4-6-8-10-12-14-16-18-26(30)34-20-24-22-36-28(32)38-24/h1-2,23-24H,3-22H2/b2-1+ |
| InChIKey | OAOZNEDUVVUILH-OWOJBTEDSA-N |
| XLogP | 5.94 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.65 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|