C11H19NO5 — CID 102112461
(2-oxo-1,3-dioxolan-4-yl)methyl 3-(butylamino)propanoate (PubChem CID 102112461) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is (2-oxo-1,3-dioxolan-4-yl)methyl 3-(butylamino)propanoate.
| Compound Name | (2-oxo-1,3-dioxolan-4-yl)methyl 3-(butylamino)propanoate |
|---|---|
| PubChem CID | 102112461 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (2-oxo-1,3-dioxolan-4-yl)methyl 3-(butylamino)propanoate |
| SMILES | CCCCNCCC(=O)OCC1COC(=O)O1 |
| InChI | InChI=1S/C11H19NO5/c1-2-3-5-12-6-4-10(13)15-7-9-8-16-11(14)17-9/h9,12H,2-8H2,1H3 |
| InChIKey | MMOPZUMUICUYRE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|